EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N6O3 |
| Net Charge | 0 |
| Average Mass | 292.299 |
| Monoisotopic Mass | 292.12839 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C12H16N6O3/c13-9(1-7-3-14-5-16-7)11(19)18-10(12(20)21)2-8-4-15-6-17-8/h3-6,9-10H,1-2,13H2,(H,14,16)(H,15,17)(H,18,19)(H,20,21)/t9-,10-/m0/s1 |
| InChIKey | SGCGMORCWLEJNZ-UWVGGRQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-His (CHEBI:74051) has functional parent L-histidine (CHEBI:15971) |
| His-His (CHEBI:74051) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| His-His (CHEBI:74051) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-histidyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-His-L-His | ChEBI |
| histidylhistidine | ChEBI |
| HH | ChEBI |
| N'alpha-Histidylhistidine | ChemIDplus |
| Histidinyl-Histidine | HMDB |
| H-L-His-L-His-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028887 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:94425 | Reaxys |
| CAS:306-14-9 | ChemIDplus |