EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:27570 - histidine
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| InChIKey | HNDVDQJCIGZPNO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histidine (CHEBI:27570) has part 1H-imidazol-4-ylmethyl group (CHEBI:50338) |
| histidine (CHEBI:27570) has role metabolite (CHEBI:25212) |
| histidine (CHEBI:27570) is a aromatic amino acid (CHEBI:33856) |
| histidine (CHEBI:27570) is a imidazoles (CHEBI:24780) |
| histidine (CHEBI:27570) is a polar amino acid (CHEBI:26167) |
| histidine (CHEBI:27570) is a α-amino acid (CHEBI:33704) |
| histidine (CHEBI:27570) is conjugate acid of histidinate(1−) (CHEBI:32529) |
| histidine (CHEBI:27570) is conjugate base of histidinium(1+) (CHEBI:32531) |
| Incoming Relation(s) |
| histidine derivative (CHEBI:24599) has functional parent histidine (CHEBI:27570) |
| α-methylhistidine (CHEBI:70960) has functional parent histidine (CHEBI:27570) |
| D-histidine (CHEBI:27947) is a histidine (CHEBI:27570) |
| L-histidine (CHEBI:15971) is a histidine (CHEBI:27570) |
| histidinium(1+) (CHEBI:32531) is conjugate acid of histidine (CHEBI:27570) |
| histidinate(1−) (CHEBI:32529) is conjugate base of histidine (CHEBI:27570) |
| N2-histidino group (CHEBI:24601) is substituent group from histidine (CHEBI:27570) |
| Nπ-histidino group (CHEBI:32533) is substituent group from histidine (CHEBI:27570) |
| Nτ-histidino group (CHEBI:32534) is substituent group from histidine (CHEBI:27570) |
| histidine residue (CHEBI:32535) is substituent group from histidine (CHEBI:27570) |
| histidyl group (CHEBI:37906) is substituent group from histidine (CHEBI:27570) |
| IUPAC Names |
|---|
| 2-amino-3-(1H-imidazol-4-yl)propanoic acid |
| histidine |
| Synonyms | Source |
|---|---|
| alpha-Amino-1H-imidazole-4-propionic acid | KEGG COMPOUND |
| DL-Histidine | KEGG COMPOUND |
| Histidin | ChEBI |
| histidina | ChEBI |
| Histidine | KEGG COMPOUND |
| Citations |
|---|