EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15971 - L-histidine
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | |||
| - | PubMed (8852895) | ||
| - | PubMed (24678285) | Source: yeast.sf.net | |
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (8852895) | ||
| - | PubMed (21988831) | ||
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-histidine (CHEBI:15971) has role Escherichia coli metabolite (CHEBI:76971) |
| L-histidine (CHEBI:15971) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-histidine (CHEBI:15971) has role algal metabolite (CHEBI:84735) |
| L-histidine (CHEBI:15971) has role human metabolite (CHEBI:77746) |
| L-histidine (CHEBI:15971) has role micronutrient (CHEBI:27027) |
| L-histidine (CHEBI:15971) has role mouse metabolite (CHEBI:75771) |
| L-histidine (CHEBI:15971) has role nutraceutical (CHEBI:50733) |
| L-histidine (CHEBI:15971) is a L-α-amino acid (CHEBI:15705) |
| L-histidine (CHEBI:15971) is a histidine (CHEBI:27570) |
| L-histidine (CHEBI:15971) is a proteinogenic amino acid (CHEBI:83813) |
| L-histidine (CHEBI:15971) is conjugate acid of L-histidinate(1−) (CHEBI:32510) |
| L-histidine (CHEBI:15971) is conjugate base of L-histidinium(1+) (CHEBI:32513) |
| L-histidine (CHEBI:15971) is enantiomer of D-histidine (CHEBI:27947) |
| L-histidine (CHEBI:15971) is tautomer of L-histidine zwitterion (CHEBI:57595) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) has functional parent L-histidine (CHEBI:15971) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) has functional parent L-histidine (CHEBI:15971) |
| L-histidine derivative (CHEBI:84076) has functional parent L-histidine (CHEBI:15971) |
| Ala-Gly-His (CHEBI:73348) has functional parent L-histidine (CHEBI:15971) |
| Ala-Leu-Leu-His (CHEBI:73365) has functional parent L-histidine (CHEBI:15971) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-histidine (CHEBI:15971) |
| Asn-Gly-Pro-His (CHEBI:176851) has functional parent L-histidine (CHEBI:15971) |
| Asn-His (CHEBI:73424) has functional parent L-histidine (CHEBI:15971) |
| Asn-Lys-His-His (CHEBI:176852) has functional parent L-histidine (CHEBI:15971) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-histidine (CHEBI:15971) |
| Asp-His (CHEBI:73451) has functional parent L-histidine (CHEBI:15971) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has functional parent L-histidine (CHEBI:15971) |
| Cys-Cys-His-His (CHEBI:73456) has functional parent L-histidine (CHEBI:15971) |
| Cys-Met-Phe-His (CHEBI:138508) has functional parent L-histidine (CHEBI:15971) |
| Gly-His (CHEBI:73515) has functional parent L-histidine (CHEBI:15971) |
| Hexa-His (CHEBI:234280) has functional parent L-histidine (CHEBI:15971) |
| His-His (CHEBI:74051) has functional parent L-histidine (CHEBI:15971) |
| His-Ile (CHEBI:141437) has functional parent L-histidine (CHEBI:15971) |
| His-Phe (CHEBI:141438) has functional parent L-histidine (CHEBI:15971) |
| Ile-His (CHEBI:73520) has functional parent L-histidine (CHEBI:15971) |
| Leu-Asn-His (CHEBI:73530) has functional parent L-histidine (CHEBI:15971) |
| Phe-His (CHEBI:73634) has functional parent L-histidine (CHEBI:15971) |
| Ser-His (CHEBI:73651) has functional parent L-histidine (CHEBI:15971) |
| Thr-Ala-His (CHEBI:73656) has functional parent L-histidine (CHEBI:15971) |
| Thr-His (CHEBI:73663) has functional parent L-histidine (CHEBI:15971) |
| Tyr-His (CHEBI:73695) has functional parent L-histidine (CHEBI:15971) |
| Val-His (CHEBI:73700) has functional parent L-histidine (CHEBI:15971) |
| α-methyl-L-histidine (CHEBI:189415) has functional parent L-histidine (CHEBI:15971) |
| L-histidinium(1+) (CHEBI:32513) is conjugate acid of L-histidine (CHEBI:15971) |
| L-histidinate(1−) (CHEBI:32510) is conjugate base of L-histidine (CHEBI:15971) |
| D-histidine (CHEBI:27947) is enantiomer of L-histidine (CHEBI:15971) |
| N2-L-histidino group (CHEBI:32515) is substituent group from L-histidine (CHEBI:15971) |
| Nπ-L-histidino group (CHEBI:32516) is substituent group from L-histidine (CHEBI:15971) |
| Nτ-L-histidino group (CHEBI:32517) is substituent group from L-histidine (CHEBI:15971) |
| L-histidine residue (CHEBI:29979) is substituent group from L-histidine (CHEBI:15971) |
| L-histidyl group (CHEBI:32514) is substituent group from L-histidine (CHEBI:15971) |
| L-histidine zwitterion (CHEBI:57595) is tautomer of L-histidine (CHEBI:15971) |
| IUPAC Names |
|---|
| L-histidine |
| (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| L-Histidine | KEGG COMPOUND |
| (S)-alpha-Amino-1H-imidazole-4-propionic acid | KEGG COMPOUND |
| HISTIDINE | PDBeChem |
| (S)-α-amino-1H-Imidazole-4-propanoic acid | NIST Chemistry WebBook |
| L-Histidin | ChEBI |
| L-(−)-histidine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00135 | KEGG COMPOUND |
| HIS | PDBeChem |
| D00032 | KEGG DRUG |
| DB00117 | DrugBank |
| HMDB0000177 | HMDB |
| HIS | MetaCyc |
| L-histidine | Wikipedia |
| YMDB00369 | YMDB |
| ECMDB00177 | ECMDB |
| C00001363 | KNApSAcK |
| Citations |
|---|