EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O4 |
| Net Charge | 0 |
| Average Mass | 242.235 |
| Monoisotopic Mass | 242.10150 |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O4/c10-6(3-14)8(15)13-7(9(16)17)1-5-2-11-4-12-5/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | YZMPDHTZJJCGEI-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-His (CHEBI:73651) has functional parent L-histidine (CHEBI:15971) |
| Ser-His (CHEBI:73651) has functional parent L-serine (CHEBI:17115) |
| Ser-His (CHEBI:73651) has role metabolite (CHEBI:25212) |
| Ser-His (CHEBI:73651) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-histidine |
| Synonyms | Source |
|---|---|
| serylhistidine | ChEBI |
| S-H | ChEBI |
| SH | ChEBI |
| L-Ser-L-His | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029041 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8701122 | Reaxys |