EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28N6O7 |
| Net Charge | 0 |
| Average Mass | 440.457 |
| Monoisotopic Mass | 440.20195 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C18H28N6O7/c1-8(2)14(24-15(27)9(3)19)17(29)22-11(5-13(25)26)16(28)23-12(18(30)31)4-10-6-20-7-21-10/h6-9,11-12,14H,4-5,19H2,1-3H3,(H,20,21)(H,22,29)(H,23,28)(H,24,27)(H,25,26)(H,30,31)/t9-,11-,12-,14-/m0/s1 |
| InChIKey | XIHHLOVIGNFBCR-HVTMNAMFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-alanine (CHEBI:16977) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-histidine (CHEBI:15971) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-valine (CHEBI:16414) |
| Ala-Val-Asp-His (CHEBI:73383) has role metabolite (CHEBI:25212) |
| Ala-Val-Asp-His (CHEBI:73383) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-valyl-L-α-aspartyl-L-histidine |
| Synonyms | Source |
|---|---|
| A-V-D-H | ChEBI |
| AVDH | ChEBI |
| L-Ala-L-Val-L-Asp-L-His | ChEBI |