EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O4 |
| Net Charge | 0 |
| Average Mass | 318.333 |
| Monoisotopic Mass | 318.13281 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C15H18N4O4/c16-12(5-9-1-3-11(20)4-2-9)14(21)19-13(15(22)23)6-10-7-17-8-18-10/h1-4,7-8,12-13,20H,5-6,16H2,(H,17,18)(H,19,21)(H,22,23)/t12-,13-/m0/s1 |
| InChIKey | ZQOOYCZQENFIMC-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-His (CHEBI:73695) has functional parent L-histidine (CHEBI:15971) |
| Tyr-His (CHEBI:73695) has functional parent L-tyrosine (CHEBI:17895) |
| Tyr-His (CHEBI:73695) has role metabolite (CHEBI:25212) |
| Tyr-His (CHEBI:73695) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tyrosyl-L-histidine |
| Synonyms | Source |
|---|---|
| YH | ChEBI |
| L-Tyr-L-His | ChEBI |
| Y-H | ChEBI |
| tyrosylhistidine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029107 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9151091 | Reaxys |