EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O3 |
| Net Charge | 0 |
| Average Mass | 302.334 |
| Monoisotopic Mass | 302.13789 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C15H18N4O3/c16-12(6-10-4-2-1-3-5-10)14(20)19-13(15(21)22)7-11-8-17-9-18-11/h1-5,8-9,12-13H,6-7,16H2,(H,17,18)(H,19,20)(H,21,22)/t12-,13-/m0/s1 |
| InChIKey | OHUXOEXBXPZKPT-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-His (CHEBI:73634) has functional parent L-histidine (CHEBI:15971) |
| Phe-His (CHEBI:73634) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-His (CHEBI:73634) has role metabolite (CHEBI:25212) |
| Phe-His (CHEBI:73634) is a dipeptide (CHEBI:46761) |
| Phe-His (CHEBI:73634) is tautomer of Phe-His zwitterion (CHEBI:147377) |
| Incoming Relation(s) |
| Phe-His zwitterion (CHEBI:147377) is tautomer of Phe-His (CHEBI:73634) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-histidine |
| Synonyms | Source |
|---|---|
| F-H | ChEBI |
| FH | ChEBI |
| phenylalanylhistidine | HMDB |
| L-Phe-L-His | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028997 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15760008 | Reaxys |