EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N4O3 |
| Net Charge | 0 |
| Average Mass | 254.290 |
| Monoisotopic Mass | 254.13789 |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C11H18N4O3/c1-6(2)9(12)10(16)15-8(11(17)18)3-7-4-13-5-14-7/h4-6,8-9H,3,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | BNQVUHQWZGTIBX-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-His (CHEBI:73700) has functional parent L-histidine (CHEBI:15971) |
| Val-His (CHEBI:73700) has functional parent L-valine (CHEBI:16414) |
| Val-His (CHEBI:73700) has role metabolite (CHEBI:25212) |
| Val-His (CHEBI:73700) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-valyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-Val-L-His | ChEBI |
| valylhistidine | ChEBI |
| V-H | ChEBI |
| VH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029129 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8699278 | Reaxys |