EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N5O5 |
| Net Charge | 0 |
| Average Mass | 327.341 |
| Monoisotopic Mass | 327.15427 |
| SMILES | C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C13H21N5O5/c1-6(17-12(21)10(14)7(2)19)11(20)18-9(13(22)23)3-8-4-15-5-16-8/h4-7,9-10,19H,3,14H2,1-2H3,(H,15,16)(H,17,21)(H,18,20)(H,22,23)/t6-,7+,9-,10-/m0/s1 |
| InChIKey | STGXWWBXWXZOER-MBLNEYKQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Ala-His (CHEBI:73656) has functional parent L-alanine (CHEBI:16977) |
| Thr-Ala-His (CHEBI:73656) has functional parent L-histidine (CHEBI:15971) |
| Thr-Ala-His (CHEBI:73656) has functional parent L-threonine (CHEBI:16857) |
| Thr-Ala-His (CHEBI:73656) has role metabolite (CHEBI:25212) |
| Thr-Ala-His (CHEBI:73656) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-threonyl-L-alanyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Ala-L-His | ChEBI |
| T-A-H | ChEBI |
| TAH | ChEBI |