EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (24831709) | ||
| - | PubMed (21988831) | ||
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25899098) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24831709) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lysine (CHEBI:18019) has role Escherichia coli metabolite (CHEBI:76971) |
| L-lysine (CHEBI:18019) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-lysine (CHEBI:18019) has role algal metabolite (CHEBI:84735) |
| L-lysine (CHEBI:18019) has role anticonvulsant (CHEBI:35623) |
| L-lysine (CHEBI:18019) has role human metabolite (CHEBI:77746) |
| L-lysine (CHEBI:18019) has role micronutrient (CHEBI:27027) |
| L-lysine (CHEBI:18019) has role mouse metabolite (CHEBI:75771) |
| L-lysine (CHEBI:18019) has role nutraceutical (CHEBI:50733) |
| L-lysine (CHEBI:18019) has role plant metabolite (CHEBI:76924) |
| L-lysine (CHEBI:18019) is a L-α-amino acid (CHEBI:15705) |
| L-lysine (CHEBI:18019) is a aspartate family amino acid (CHEBI:22658) |
| L-lysine (CHEBI:18019) is a lysine (CHEBI:25094) |
| L-lysine (CHEBI:18019) is a proteinogenic amino acid (CHEBI:83813) |
| L-lysine (CHEBI:18019) is conjugate acid of L-lysinate (CHEBI:32550) |
| L-lysine (CHEBI:18019) is conjugate base of L-lysinium(1+) (CHEBI:32551) |
| L-lysine (CHEBI:18019) is enantiomer of D-lysine (CHEBI:16855) |
| L-lysine (CHEBI:18019) is tautomer of L-lysine zwitterion (CHEBI:133538) |
| L-lysine (CHEBI:18019) is tautomer of L-Lysine zwitterion (CHEBI:194466) |
| Incoming Relation(s) |
| p-Ts-L-Lys-Me (CHEBI:45847) has functional parent L-lysine (CHEBI:18019) |
| L-Lys-D-Asp (CHEBI:144741) has functional parent L-lysine (CHEBI:18019) |
| L-Lys-D-Glu (CHEBI:144743) has functional parent L-lysine (CHEBI:18019) |
| L-lysine derivative (CHEBI:25095) has functional parent L-lysine (CHEBI:18019) |
| L-lysyl-L-amino acid (CHEBI:134263) has functional parent L-lysine (CHEBI:18019) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent L-lysine (CHEBI:18019) |
| Asn-Lys-His-His (CHEBI:176852) has functional parent L-lysine (CHEBI:18019) |
| Asp-Lys (CHEBI:73829) has functional parent L-lysine (CHEBI:18019) |
| Asp-Lys-Ile (CHEBI:138791) has functional parent L-lysine (CHEBI:18019) |
| desmosine (CHEBI:37628) has functional parent L-lysine (CHEBI:18019) |
| Glu-Glu-Lys (CHEBI:156360) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys (CHEBI:73521) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-lysine (CHEBI:18019) |
| Ile-Lys (CHEBI:141440) has functional parent L-lysine (CHEBI:18019) |
| Leu-Lys (CHEBI:73583) has functional parent L-lysine (CHEBI:18019) |
| Leu-Lys-Asp (CHEBI:138514) has functional parent L-lysine (CHEBI:18019) |
| Lys-Ala (CHEBI:61872) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp (CHEBI:73601) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp-Tyr (CHEBI:73598) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gln (CHEBI:73600) has functional parent L-lysine (CHEBI:18019) |
| Lys-Glu-Glu (CHEBI:144461) has functional parent L-lysine (CHEBI:18019) |
| Lys-Glu-Thr (CHEBI:144459) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gly (CHEBI:73604) has functional parent L-lysine (CHEBI:18019) |
| Lys-Leu-Ser (CHEBI:156358) has functional parent L-lysine (CHEBI:18019) |
| Lys-Lys-Leu (CHEBI:156355) has functional parent L-lysine (CHEBI:18019) |
| Lys-Met-Met-Met (CHEBI:73595) has functional parent L-lysine (CHEBI:18019) |
| Lys-Phe (CHEBI:73605) has functional parent L-lysine (CHEBI:18019) |
| Lys-Ser-Trp (CHEBI:144474) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr (CHEBI:73606) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-lysine (CHEBI:18019) |
| Lys-Tyr (CHEBI:73608) has functional parent L-lysine (CHEBI:18019) |
| Lys-Tyr-Glu (CHEBI:140742) has functional parent L-lysine (CHEBI:18019) |
| Lys-Val (CHEBI:73607) has functional parent L-lysine (CHEBI:18019) |
| Phe-Lys (CHEBI:141443) has functional parent L-lysine (CHEBI:18019) |
| Ser-Asp-Lys (CHEBI:162959) has functional parent L-lysine (CHEBI:18019) |
| Ser-Asp-Lys-Pro (CHEBI:191177) has functional parent L-lysine (CHEBI:18019) |
| Ser-Lys (CHEBI:144702) has functional parent L-lysine (CHEBI:18019) |
| Ser-Trp-Lys (CHEBI:144904) has functional parent L-lysine (CHEBI:18019) |
| Thr-Lys (CHEBI:157893) has functional parent L-lysine (CHEBI:18019) |
| L-lysine hydrochloride (CHEBI:53633) has part L-lysine (CHEBI:18019) |
| royal jelly (CHEBI:78665) has part L-lysine (CHEBI:18019) |
| L-lysinium(1+) (CHEBI:32551) is conjugate acid of L-lysine (CHEBI:18019) |
| L-lysinate (CHEBI:32550) is conjugate base of L-lysine (CHEBI:18019) |
| D-lysine (CHEBI:16855) is enantiomer of L-lysine (CHEBI:18019) |
| N2-L-lysino group (CHEBI:32554) is substituent group from L-lysine (CHEBI:18019) |
| N6-L-lysino group (CHEBI:32555) is substituent group from L-lysine (CHEBI:18019) |
| L-lysine residue (CHEBI:29967) is substituent group from L-lysine (CHEBI:18019) |
| L-lysyl group (CHEBI:32553) is substituent group from L-lysine (CHEBI:18019) |
| L-lysine zwitterion (CHEBI:133538) is tautomer of L-lysine (CHEBI:18019) |
| L-Lysine zwitterion (CHEBI:194466) is tautomer of L-lysine (CHEBI:18019) |
| IUPAC Names |
|---|
| (2S)-2,6-diaminohexanoic acid |
| L-lysine |
| INNs | Source |
|---|---|
| lysina | WHO MedNet |
| lysine | WHO MedNet |
| lysine | WHO MedNet |
| lysinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-ammonio-L-norleucine | PDBeChem |
| (S)-2,6-diaminohexanoic acid | NIST Chemistry WebBook |
| (S)-lysine | NIST Chemistry WebBook |
| (S)-α,ε-diaminocaproic acid | NIST Chemistry WebBook |
| K | NIST Chemistry WebBook |
| L-2,6-Diaminocaproic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 1622 | DrugCentral |
| C00001378 | KNApSAcK |
| C00047 | KEGG COMPOUND |
| D02304 | KEGG DRUG |
| DB00123 | DrugBank |
| ECMDB00182 | ECMDB |
| HMDB0000182 | HMDB |
| LYS | MetaCyc |
| Lysine | Wikipedia |
| YMDB00330 | YMDB |
| Citations |
|---|