EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (24831709) | ||
| - | PubMed (21988831) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24831709) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25899098) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lysine (CHEBI:18019) has role Escherichia coli metabolite (CHEBI:76971) |
| L-lysine (CHEBI:18019) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-lysine (CHEBI:18019) has role algal metabolite (CHEBI:84735) |
| L-lysine (CHEBI:18019) has role anticonvulsant (CHEBI:35623) |
| L-lysine (CHEBI:18019) has role human metabolite (CHEBI:77746) |
| L-lysine (CHEBI:18019) has role micronutrient (CHEBI:27027) |
| L-lysine (CHEBI:18019) has role mouse metabolite (CHEBI:75771) |
| L-lysine (CHEBI:18019) has role nutraceutical (CHEBI:50733) |
| L-lysine (CHEBI:18019) has role plant metabolite (CHEBI:76924) |
| L-lysine (CHEBI:18019) is a L-α-amino acid (CHEBI:15705) |
| L-lysine (CHEBI:18019) is a aspartate family amino acid (CHEBI:22658) |
| L-lysine (CHEBI:18019) is a lysine (CHEBI:25094) |
| L-lysine (CHEBI:18019) is a proteinogenic amino acid (CHEBI:83813) |
| L-lysine (CHEBI:18019) is conjugate acid of L-lysinate (CHEBI:32550) |
| L-lysine (CHEBI:18019) is conjugate base of L-lysinium(1+) (CHEBI:32551) |
| L-lysine (CHEBI:18019) is enantiomer of D-lysine (CHEBI:16855) |
| L-lysine (CHEBI:18019) is tautomer of L-lysine zwitterion (CHEBI:133538) |
| L-lysine (CHEBI:18019) is tautomer of L-Lysine zwitterion (CHEBI:194466) |
| Incoming Relation(s) |
| p-Ts-L-Lys-Me (CHEBI:45847) has functional parent L-lysine (CHEBI:18019) |
| L-Lys-D-Asp (CHEBI:144741) has functional parent L-lysine (CHEBI:18019) |
| L-Lys-D-Glu (CHEBI:144743) has functional parent L-lysine (CHEBI:18019) |
| L-lysine derivative (CHEBI:25095) has functional parent L-lysine (CHEBI:18019) |
| L-lysyl-L-amino acid (CHEBI:134263) has functional parent L-lysine (CHEBI:18019) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent L-lysine (CHEBI:18019) |
| Asn-Lys-His-His (CHEBI:176852) has functional parent L-lysine (CHEBI:18019) |
| Asp-Lys (CHEBI:73829) has functional parent L-lysine (CHEBI:18019) |
| Asp-Lys-Ile (CHEBI:138791) has functional parent L-lysine (CHEBI:18019) |
| desmosine (CHEBI:37628) has functional parent L-lysine (CHEBI:18019) |
| Glu-Glu-Lys (CHEBI:156360) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys (CHEBI:73521) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-lysine (CHEBI:18019) |
| Ile-Lys (CHEBI:141440) has functional parent L-lysine (CHEBI:18019) |
| Leu-Lys (CHEBI:73583) has functional parent L-lysine (CHEBI:18019) |
| Leu-Lys-Asp (CHEBI:138514) has functional parent L-lysine (CHEBI:18019) |
| Lys-Ala (CHEBI:61872) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp (CHEBI:73601) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp-Tyr (CHEBI:73598) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gln (CHEBI:73600) has functional parent L-lysine (CHEBI:18019) |
| Lys-Glu-Glu (CHEBI:144461) has functional parent L-lysine (CHEBI:18019) |
| Lys-Glu-Thr (CHEBI:144459) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gly (CHEBI:73604) has functional parent L-lysine (CHEBI:18019) |
| Lys-Leu-Ser (CHEBI:156358) has functional parent L-lysine (CHEBI:18019) |
| Lys-Lys-Leu (CHEBI:156355) has functional parent L-lysine (CHEBI:18019) |
| Lys-Met-Met-Met (CHEBI:73595) has functional parent L-lysine (CHEBI:18019) |
| Lys-Phe (CHEBI:73605) has functional parent L-lysine (CHEBI:18019) |
| Lys-Ser-Trp (CHEBI:144474) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr (CHEBI:73606) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-lysine (CHEBI:18019) |
| Lys-Tyr (CHEBI:73608) has functional parent L-lysine (CHEBI:18019) |
| Lys-Tyr-Glu (CHEBI:140742) has functional parent L-lysine (CHEBI:18019) |
| Lys-Val (CHEBI:73607) has functional parent L-lysine (CHEBI:18019) |
| Phe-Lys (CHEBI:141443) has functional parent L-lysine (CHEBI:18019) |
| Ser-Asp-Lys (CHEBI:162959) has functional parent L-lysine (CHEBI:18019) |
| Ser-Asp-Lys-Pro (CHEBI:191177) has functional parent L-lysine (CHEBI:18019) |
| Ser-Lys (CHEBI:144702) has functional parent L-lysine (CHEBI:18019) |
| Ser-Trp-Lys (CHEBI:144904) has functional parent L-lysine (CHEBI:18019) |
| Thr-Lys (CHEBI:157893) has functional parent L-lysine (CHEBI:18019) |
| L-lysine hydrochloride (CHEBI:53633) has part L-lysine (CHEBI:18019) |
| royal jelly (CHEBI:78665) has part L-lysine (CHEBI:18019) |
| L-lysinium(1+) (CHEBI:32551) is conjugate acid of L-lysine (CHEBI:18019) |
| L-lysinate (CHEBI:32550) is conjugate base of L-lysine (CHEBI:18019) |
| D-lysine (CHEBI:16855) is enantiomer of L-lysine (CHEBI:18019) |
| N2-L-lysino group (CHEBI:32554) is substituent group from L-lysine (CHEBI:18019) |
| N6-L-lysino group (CHEBI:32555) is substituent group from L-lysine (CHEBI:18019) |
| L-lysine residue (CHEBI:29967) is substituent group from L-lysine (CHEBI:18019) |
| L-lysyl group (CHEBI:32553) is substituent group from L-lysine (CHEBI:18019) |
| L-lysine zwitterion (CHEBI:133538) is tautomer of L-lysine (CHEBI:18019) |
| L-Lysine zwitterion (CHEBI:194466) is tautomer of L-lysine (CHEBI:18019) |
| IUPAC Names |
|---|
| L-lysine |
| (2S)-2,6-diaminohexanoic acid |
| INNs | Source |
|---|---|
| lysine | WHO MedNet |
| lysina | WHO MedNet |
| lysinum | WHO MedNet |
| lysine | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-Lysine | KEGG COMPOUND |
| Lysine acid | KEGG COMPOUND |
| (S)-α,ε-diaminocaproic acid | NIST Chemistry WebBook |
| (S)-2,6-diaminohexanoic acid | NIST Chemistry WebBook |
| Lys | NIST Chemistry WebBook |
| K | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00047 | KEGG COMPOUND |
| D02304 | KEGG DRUG |
| DB00123 | DrugBank |
| HMDB0000182 | HMDB |
| LYS | MetaCyc |
| Lysine | Wikipedia |
| YMDB00330 | YMDB |
| ECMDB00182 | ECMDB |
| C00001378 | KNApSAcK |
| 1622 | DrugCentral |
| Citations |
|---|