EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O3 |
| Net Charge | 0 |
| Average Mass | 203.242 |
| Monoisotopic Mass | 203.12699 |
| SMILES | NCCCC[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H17N3O3/c9-4-2-1-3-6(10)8(14)11-5-7(12)13/h6H,1-5,9-10H2,(H,11,14)(H,12,13)/t6-/m0/s1 |
| InChIKey | HGNRJCINZYHNOU-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Gly (CHEBI:73604) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gly (CHEBI:73604) has functional parent glycine (CHEBI:15428) |
| Lys-Gly (CHEBI:73604) has role metabolite (CHEBI:25212) |
| Lys-Gly (CHEBI:73604) is a dipeptide (CHEBI:46761) |
| Lys-Gly (CHEBI:73604) is conjugate base of Lys-Gly(1+) (CHEBI:191202) |
| Incoming Relation(s) |
| Lys-Gly(1+) (CHEBI:191202) is conjugate acid of Lys-Gly (CHEBI:73604) |
| IUPAC Name |
|---|
| L-lysylglycine |
| Synonyms | Source |
|---|---|
| L-Lys-Gly | ChEBI |
| KG | ChEBI |
| K-G | ChEBI |
| lysylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028951 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726834 | Reaxys |