EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N6O7 |
| Net Charge | 0 |
| Average Mass | 532.598 |
| Monoisotopic Mass | 532.26455 |
| SMILES | C[C@H](NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H36N6O7/c1-14(25(37)38)29-24(36)20(12-15-13-28-18-7-3-2-6-16(15)18)31-23(35)19(8-4-5-11-26)30-22(34)17(27)9-10-21(32)33/h2-3,6-7,13-14,17,19-20,28H,4-5,8-12,26-27H2,1H3,(H,29,36)(H,30,34)(H,31,35)(H,32,33)(H,37,38)/t14-,17-,19-,20-/m0/s1 |
| InChIKey | KDIBIWPCJYUPOI-HSCHXYMDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-alanine (CHEBI:16977) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has functional parent L-tryptophan (CHEBI:16828) |
| Glu-Lys-Trp-Ala (CHEBI:73487) has role metabolite (CHEBI:25212) |
| Glu-Lys-Trp-Ala (CHEBI:73487) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-lysyl-L-tryptophyl-L-alanine |
| Synonyms | Source |
|---|---|
| E-K-W-A | ChEBI |
| EKWA | ChEBI |
| L-Glu-L-Lys-L-Trp-L-Ala | ChEBI |