EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O3S |
| Net Charge | 0 |
| Average Mass | 298.408 |
| Monoisotopic Mass | 298.13511 |
| SMILES | CC(=O)[C@H](CCCCN)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-11-6-8-13(9-7-11)20(18,19)16-14(12(2)17)5-3-4-10-15/h6-9,14,16H,3-5,10,15H2,1-2H3/t14-/m0/s1 |
| InChIKey | KARUWQQASOADOA-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-Ts-L-Lys-Me (CHEBI:45847) has functional parent L-lysine (CHEBI:18019) |
| p-Ts-L-Lys-Me (CHEBI:45847) has role metabolite (CHEBI:25212) |
| p-Ts-L-Lys-Me (CHEBI:45847) is a methyl ketone (CHEBI:51867) |
| p-Ts-L-Lys-Me (CHEBI:45847) is a primary amine (CHEBI:32877) |
| p-Ts-L-Lys-Me (CHEBI:45847) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[(3S)-7-amino-2-oxoheptan-3-yl]-4-methylbenzenesulfonamide |
| Synonym | Source |
|---|---|
| N-tosyl-L-lysinyl methyl ketone | ChEBI |
| Citations |
|---|