EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O5 |
| Net Charge | 0 |
| Average Mass | 261.278 |
| Monoisotopic Mass | 261.13247 |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5/c11-4-2-1-3-6(12)9(16)13-7(10(17)18)5-8(14)15/h6-7H,1-5,11-12H2,(H,13,16)(H,14,15)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | CIOWSLJGLSUOME-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Asp (CHEBI:73601) has functional parent L-aspartic acid (CHEBI:17053) |
| Lys-Asp (CHEBI:73601) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp (CHEBI:73601) has role metabolite (CHEBI:25212) |
| Lys-Asp (CHEBI:73601) is a dipeptide (CHEBI:46761) |
| Lys-Asp (CHEBI:73601) is tautomer of Lys-Asp zwitterion (CHEBI:229969) |
| Incoming Relation(s) |
| Lys-Asp zwitterion (CHEBI:229969) is tautomer of Lys-Asp (CHEBI:73601) |
| IUPAC Name |
|---|
| L-lysyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| K-D | ChEBI |
| KD | ChEBI |
| lysylaspartic acid | ChEBI |
| L-Lys-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028947 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714735 | Reaxys |