EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:25094 - lysine
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| InChIKey | KDXKERNSBIXSRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysine (CHEBI:25094) has functional parent hexanoic acid (CHEBI:30776) |
| lysine (CHEBI:25094) has part 4-aminobutyl group (CHEBI:50339) |
| lysine (CHEBI:25094) has role Daphnia magna metabolite (CHEBI:83056) |
| lysine (CHEBI:25094) is a diamino acid (CHEBI:35987) |
| lysine (CHEBI:25094) is a polar amino acid (CHEBI:26167) |
| lysine (CHEBI:25094) is a α-amino acid (CHEBI:33704) |
| lysine (CHEBI:25094) is conjugate acid of lysinate (CHEBI:32563) |
| lysine (CHEBI:25094) is conjugate base of lysinium(1+) (CHEBI:32564) |
| Incoming Relation(s) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) has functional parent lysine (CHEBI:25094) |
| 2-(difluoromethyl)lysine (CHEBI:74111) has functional parent lysine (CHEBI:25094) |
| lysine derivative (CHEBI:53079) has functional parent lysine (CHEBI:25094) |
| D-lysine (CHEBI:16855) is a lysine (CHEBI:25094) |
| L-lysine (CHEBI:18019) is a lysine (CHEBI:25094) |
| lysinium(1+) (CHEBI:32564) is conjugate acid of lysine (CHEBI:25094) |
| lysinate (CHEBI:32563) is conjugate base of lysine (CHEBI:25094) |
| N2-lysino group (CHEBI:32566) is substituent group from lysine (CHEBI:25094) |
| N6-lysino group (CHEBI:32567) is substituent group from lysine (CHEBI:25094) |
| lysine residue (CHEBI:32568) is substituent group from lysine (CHEBI:25094) |
| lysyl group (CHEBI:37903) is substituent group from lysine (CHEBI:25094) |
| IUPAC Names |
|---|
| 2,6-diaminohexanoic acid |
| lysine |
| Synonyms | Source |
|---|---|
| K | ChEBI |
| LYS | ChEBI |
| Lysin | ChEBI |
| α,ε-diaminocaproic acid | ChEBI |
| Citations |
|---|