EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N3O3 |
| Net Charge | 0 |
| Average Mass | 245.323 |
| Monoisotopic Mass | 245.17394 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C11H23N3O3/c1-7(2)9(11(16)17)14-10(15)8(13)5-3-4-6-12/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | YQAIUOWPSUOINN-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Val (CHEBI:73607) has functional parent L-lysine (CHEBI:18019) |
| Lys-Val (CHEBI:73607) has functional parent L-valine (CHEBI:16414) |
| Lys-Val (CHEBI:73607) has role metabolite (CHEBI:25212) |
| Lys-Val (CHEBI:73607) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-valine |
| Synonyms | Source |
|---|---|
| K-V | ChEBI |
| KV | ChEBI |
| Lysylvaline | HMDB |
| L-Lys-L-Val | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028964 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2375614 | Reaxys |
| CAS:20556-11-0 | ChemIDplus |