EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N3O5 |
| Net Charge | 0 |
| Average Mass | 275.305 |
| Monoisotopic Mass | 275.14812 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c12-6-2-1-3-8(11(18)19)14-10(17)7(13)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | BBBXWRGITSUJPB-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Lys (CHEBI:73521) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Lys (CHEBI:73521) has functional parent L-lysine (CHEBI:18019) |
| Glu-Lys (CHEBI:73521) has role metabolite (CHEBI:25212) |
| Glu-Lys (CHEBI:73521) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-lysine |
| Synonyms | Source |
|---|---|
| EK | ChEBI |
| L-Glu-L-Lys | ChEBI |
| E-K | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028824 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2470443 | Reaxys |