EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N6O7 |
| Net Charge | 0 |
| Average Mass | 596.685 |
| Monoisotopic Mass | 596.29585 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H40N6O7/c1-17(37)26(36-27(39)22(32)7-4-5-13-31)29(41)34-24(15-19-16-33-23-8-3-2-6-21(19)23)28(40)35-25(30(42)43)14-18-9-11-20(38)12-10-18/h2-3,6,8-12,16-17,22,24-26,33,37-38H,4-5,7,13-15,31-32H2,1H3,(H,34,41)(H,35,40)(H,36,39)(H,42,43)/t17-,22+,24+,25+,26+/m1/s1 |
| InChIKey | JMENHIOOENGKIL-JGFWFPDNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-threonine (CHEBI:16857) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-tryptophan (CHEBI:16828) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has functional parent L-tyrosine (CHEBI:17895) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) has role metabolite (CHEBI:25212) |
| Lys-Thr-Trp-Tyr (CHEBI:73597) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-lysyl-L-threonyl-L-tryptophyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| K-T-W-Y | ChEBI |
| KTWY | ChEBI |
| L-Lys-L-Thr-L-Trp-L-Tyr | ChEBI |