EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34N8O5S |
| Net Charge | 0 |
| Average Mass | 462.577 |
| Monoisotopic Mass | 462.23729 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H34N8O5S/c18-6-2-1-5-11(24-14(28)10(19)4-3-7-22-17(20)21)16(30)25-12(9-31)15(29)23-8-13(26)27/h10-12,31H,1-9,18-19H2,(H,23,29)(H,24,28)(H,25,30)(H,26,27)(H4,20,21,22)/t10-,11-,12-/m0/s1 |
| InChIKey | DQBFZVFOKCEJMC-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent L-arginine (CHEBI:16467) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent L-cysteine (CHEBI:17561) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent L-lysine (CHEBI:18019) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has functional parent glycine (CHEBI:15428) |
| Arg-Lys-Cys-Gly (CHEBI:73401) has role metabolite (CHEBI:25212) |
| Arg-Lys-Cys-Gly (CHEBI:73401) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-arginyl-L-lysyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| R-K-C-G | ChEBI |
| RKCG | ChEBI |
| L-Arg-L-Lys-L-Cys-Gly | ChEBI |