EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O5 |
| Net Charge | 0 |
| Average Mass | 261.278 |
| Monoisotopic Mass | 261.13247 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5/c11-4-2-1-3-7(10(17)18)13-9(16)6(12)5-8(14)15/h6-7H,1-5,11-12H2,(H,13,16)(H,14,15)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | OAMLVOVXNKILLQ-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Lys (CHEBI:73829) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Lys (CHEBI:73829) has functional parent L-lysine (CHEBI:18019) |
| Asp-Lys (CHEBI:73829) has role metabolite (CHEBI:25212) |
| Asp-Lys (CHEBI:73829) is a dipeptide (CHEBI:46761) |
| Asp-Lys (CHEBI:73829) is tautomer of Asp-Lys zwitterion (CHEBI:229953) |
| Incoming Relation(s) |
| Asp-Lys zwitterion (CHEBI:229953) is tautomer of Asp-Lys (CHEBI:73829) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-lysine |
| Synonyms | Source |
|---|---|
| Alpha-Aspartyl-lysine | HMDB |
| aspartyllysine | ChEBI |
| D-K | ChEBI |
| DK | ChEBI |
| DK dipeptide | ChEBI |
| L-aspartyl-L-lysine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB023571 | FooDB |
| HMDB0004987 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2470578 | Reaxys |
| CAS:5891-51-0 | HMDB |