EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35N5O6 |
| Net Charge | 0 |
| Average Mass | 441.529 |
| Monoisotopic Mass | 441.25873 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H35N5O6/c1-12(26)16(23-17(27)13(22)6-2-3-9-21)19(29)24-10-4-7-14(24)18(28)25-11-5-8-15(25)20(30)31/h12-16,26H,2-11,21-22H2,1H3,(H,23,27)(H,30,31)/t12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | ZVXSESPJMKNIQA-YXMSTPNBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has functional parent L-proline (CHEBI:17203) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has functional parent L-threonine (CHEBI:16857) |
| Lys-Thr-Pro-Pro (CHEBI:73596) has role metabolite (CHEBI:25212) |
| Lys-Thr-Pro-Pro (CHEBI:73596) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-lysyl-L-threonyl-L-prolyl-L-proline |
| Synonyms | Source |
|---|---|
| K-T-P-P | ChEBI |
| KTPP | ChEBI |
| L-Lys-L-Thr-L-Pro-L-Pro | ChEBI |