EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N3O3R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 202.231 |
| Monoisotopic Mass (excl. R groups) | 202.11917 |
| SMILES | *[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (2143188) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lysyl-L-amino acid (CHEBI:134263) has functional parent L-lysine (CHEBI:18019) |
| L-lysyl-L-amino acid (CHEBI:134263) is a dipeptide (CHEBI:46761) |
| Synonym | Source |
|---|---|
| Lys-Xaa | ChEBI |
| Citations |
|---|