EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N3O4 |
| Net Charge | 0 |
| Average Mass | 247.295 |
| Monoisotopic Mass | 247.15321 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C10H21N3O4/c1-6(14)8(10(16)17)13-9(15)7(12)4-2-3-5-11/h6-8,14H,2-5,11-12H2,1H3,(H,13,15)(H,16,17)/t6-,7+,8+/m1/s1 |
| InChIKey | ZOKVLMBYDSIDKG-CSMHCCOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Thr (CHEBI:73606) has functional parent L-lysine (CHEBI:18019) |
| Lys-Thr (CHEBI:73606) has functional parent L-threonine (CHEBI:16857) |
| Lys-Thr (CHEBI:73606) has role metabolite (CHEBI:25212) |
| Lys-Thr (CHEBI:73606) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-threonine |
| Synonyms | Source |
|---|---|
| K-T | ChEBI |
| KT | ChEBI |
| lysylthreonine | ChEBI |
| Lysyl-Threonine | HMDB |
| L-Lys-L-Thr | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028961 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5030946 | Reaxys |