EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40N5O8 |
| Net Charge | +1 |
| Average Mass | 526.611 |
| Monoisotopic Mass | 526.28714 |
| SMILES | N[C@@H](CCCC[n+]1cc(CC[C@H](N)C(=O)O)c(CCC[C@H](N)C(=O)O)c(CC[C@H](N)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C24H39N5O8/c25-17(21(30)31)5-1-2-11-29-12-14(7-9-19(27)23(34)35)16(4-3-6-18(26)22(32)33)15(13-29)8-10-20(28)24(36)37/h12-13,17-20H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1/t17-,18-,19-,20-/m0/s1 |
| InChIKey | VEVRNHHLCPGNDU-MUGJNUQGSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmosine (CHEBI:37628) has functional parent L-lysine (CHEBI:18019) |
| desmosine (CHEBI:37628) is a aromatic amino acid (CHEBI:33856) |
| Incoming Relation(s) |
| desmosine residue (CHEBI:37629) is substituent group from desmosine (CHEBI:37628) |
| IUPAC Name |
|---|
| 4-[(4S)-4-amino-4-carboxybutyl]-1-[(5S)-5-amino-5-carboxypentyl]-3,5-bis[(3S)-3-amino-3-carboxypropyl]pyridinium |
| Synonym | Source |
|---|---|
| Des | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4074277 | Beilstein |
| CAS:11003-57-9 | ChemIDplus |