EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28N4O7 |
| Net Charge | 0 |
| Average Mass | 424.454 |
| Monoisotopic Mass | 424.19580 |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H28N4O7/c20-8-2-1-3-13(21)17(27)22-14(10-16(25)26)18(28)23-15(19(29)30)9-11-4-6-12(24)7-5-11/h4-7,13-15,24H,1-3,8-10,20-21H2,(H,22,27)(H,23,28)(H,25,26)(H,29,30)/t13-,14-,15-/m0/s1 |
| InChIKey | NTBFKPBULZGXQL-KKUMJFAQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Asp-Tyr (CHEBI:73598) has functional parent L-aspartic acid (CHEBI:17053) |
| Lys-Asp-Tyr (CHEBI:73598) has functional parent L-lysine (CHEBI:18019) |
| Lys-Asp-Tyr (CHEBI:73598) has functional parent L-tyrosine (CHEBI:17895) |
| Lys-Asp-Tyr (CHEBI:73598) has role metabolite (CHEBI:25212) |
| Lys-Asp-Tyr (CHEBI:73598) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-lysyl-L-α-aspartyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Lys-L-Asp-L-Tyr | ChEBI |
| KDY | ChEBI |
| K-D-Y | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15609625 | Reaxys |