EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N4O4 |
| Net Charge | 0 |
| Average Mass | 274.321 |
| Monoisotopic Mass | 274.16411 |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H22N4O4/c12-6-2-1-3-7(13)10(17)15-8(11(18)19)4-5-9(14)16/h7-8H,1-6,12-13H2,(H2,14,16)(H,15,17)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | OAPNERBWQWUPTI-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Gln (CHEBI:73600) has functional parent L-glutamine (CHEBI:18050) |
| Lys-Gln (CHEBI:73600) has functional parent L-lysine (CHEBI:18019) |
| Lys-Gln (CHEBI:73600) has role metabolite (CHEBI:25212) |
| Lys-Gln (CHEBI:73600) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-glutamine |
| Synonyms | Source |
|---|---|
| L-Lys-L-Gln | ChEBI |
| K-Q | ChEBI |
| KQ | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028949 | HMDB |