EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| InChIKey | IQPNAANSBPBGFQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cirsium japonicum (ncbitaxon:516546) | whole plant (BTO:0001461) | PubMed (21899269) | Hot methanolic extract of dried whole plant |
| Olea europaea (ncbitaxon:4146) | leaf (BTO:0000713) | PubMed (22014168) | Methanolic extract of dried olive leaves |
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial part |
| Brassica napus (ncbitaxon:3708) | |||
| leaf lamina (BTO:0000719) | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS312) | From MetaboLights | |
| Sorghum bicolor (ncbitaxon:4558) | - | MetaboLights (MTBLS69) | From MetaboLights |
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| cell suspension culture (BTO:0000221) | MetaboLights (MTBLS311) | From MetaboLights | |
| - | MetaboLights (MTBLS129) | From MetaboLights | |
| Lepisorus ussuriensis (ncbitaxon:699700) | whole plant (BTO:0001461) | PubMed (26569039) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Luteolin | KEGG COMPOUND |
| 3',4',5,7-Tetrahydroxyflavone | KEGG COMPOUND |
| 5,7,3',4'-Tetrahydroxyflavone | KEGG COMPOUND |
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-benzopyrone | ChemIDplus |
| Luteolol | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01514 | KEGG COMPOUND |
| LMPK12110006 | LIPID MAPS |
| 5734-TETRAHYDROXYFLAVONE | MetaCyc |
| Luteolin | Wikipedia |
| HMDB0005800 | HMDB |
| C00000674 | KNApSAcK |
| LSM-5229 | LINCS |
| LU2 | PDBeChem |
| DB15584 | DrugBank |
| FDB013255 | FooDB |
| 4444102 | ChemSpider |
| Citations |
|---|