EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | PEFNSGRTCBGNAN-QNDFHXLGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cirsium japonicum (ncbitaxon:516546) | whole plant (BTO:0001461) | PubMed (21899269) | Hot methanolic extract of dried whole plant |
| Olea europaea (ncbitaxon:4146) | leaf (BTO:0000713) | PubMed (22014168) | Methanolic and aqueous extract of dried olive leaves |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) has functional parent luteolin (CHEBI:15864) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) has role antioxidant (CHEBI:22586) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) has role plant metabolite (CHEBI:76924) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) is a glycosyloxyflavone (CHEBI:50018) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) is a monosaccharide derivative (CHEBI:63367) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) is a trihydroxyflavone (CHEBI:27116) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) is a β-D-glucoside (CHEBI:22798) |
| luteolin 7-O-β-D-glucoside (CHEBI:27994) is conjugate acid of luteolin 7-O-β-D-glucoside(1−) (CHEBI:77791) |
| Incoming Relation(s) |
| luteolin 7-O-β-D-glucoside-4'-(Z-2-methyl-2-butenoate) (CHEBI:85149) has functional parent luteolin 7-O-β-D-glucoside (CHEBI:27994) |
| luteolin 7-O-β-D-glucoside(1−) (CHEBI:77791) is conjugate base of luteolin 7-O-β-D-glucoside (CHEBI:27994) |
| IUPAC Name |
|---|
| 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(3,4-dihydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl β-D-glucopyranoside | ChEBI |
| 2-(3,4-dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one | ChEBI |
| 7-Glucoluteolin | ChemIDplus |
| 7-Glucosylluteolin | ChemIDplus |
| 7-O-beta-D-Glucosyl-5,7,3',4'-tetrahydroxyflavone | KEGG COMPOUND |
| Cinaroside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00004266 | KNApSAcK |
| C03951 | KEGG COMPOUND |
| CN101474196 | Patent |
| Cynaroside | Wikipedia |
| HMDB0035588 | HMDB |
| LMPK12110642 | LIPID MAPS |
| LUTEOLIN-7-O-BETA-D-GLUCOSIDE | MetaCyc |
| US2011207684 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:66982 | Reaxys |
| CAS:5373-11-5 | KEGG COMPOUND |
| CAS:5373-11-5 | ChemIDplus |
| Citations |
|---|