EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](Oc3cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc4c3)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-7,9,18,20-31,33-37H,8H2,1H3/t9-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | SHPPXMGVUDNKLV-KMFFXDMSSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) has functional parent luteolin (CHEBI:15864) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) has role antibacterial agent (CHEBI:33282) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) has role metabolite (CHEBI:25212) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) is a disaccharide derivative (CHEBI:63353) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) is a glycosyloxyflavone (CHEBI:50018) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) is a neohesperidoside (CHEBI:25495) |
| luteolin 7-O-neohesperidoside (CHEBI:31788) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl 2-O-(α-L-rhamnopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-((2-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| Lonicerin | ChemIDplus |
| Luteolin 7-O-neohesperidoside | KEGG COMPOUND |
| Luteolin 7-O-neohesperidoside | KEGG COMPOUND |
| Luteolin-7-O-rhamnoside | ChemIDplus |
| Luteolin-7-rutinoside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00004283 | KNApSAcK |
| C12630 | KEGG COMPOUND |
| HMDB0005799 | HMDB |
| KR20050005633 | Patent |
| LUTEOLIN-7-O-NEOHESPERIDOSIDE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1361176 | Reaxys |
| CAS:25694-72-8 | KEGG COMPOUND |
| CAS:25694-72-8 | ChemIDplus |
| Citations |
|---|