EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O7 |
| Net Charge | 0 |
| Average Mass | 302.238 |
| Monoisotopic Mass | 302.04265 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7/c16-7-2-1-6(3-8(7)17)12-5-10(19)13-9(18)4-11(20)14(21)15(13)22-12/h1-5,16-18,20-21H |
| InChIKey | ASOIXDIITRKTOX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sideritis scardica (ncbitaxon:155261) | - | PubMed (24102372) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypolaetin (CHEBI:5837) has functional parent luteolin (CHEBI:15864) |
| hypolaetin (CHEBI:5837) has role antioxidant (CHEBI:22586) |
| hypolaetin (CHEBI:5837) has role plant metabolite (CHEBI:76924) |
| hypolaetin (CHEBI:5837) is a pentahydroxyflavone (CHEBI:25883) |
| Incoming Relation(s) |
| theograndin II (CHEBI:66218) has functional parent hypolaetin (CHEBI:5837) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7,8-trihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Hypolaetin | KEGG COMPOUND |
| 8-Hydroxyluteolin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10078 | KEGG COMPOUND |
| LMPK12111397 | LIPID MAPS |
| C00001053 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:317464 | Reaxys |
| CAS:27696-41-9 | KEGG COMPOUND |
| Citations |
|---|