EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@@H](O)CO[C@H]2c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28O14/c1-8-19(32)22(35)23(36)26(38-8)40-25-20(33)14(31)7-37-24(25)18-13(30)6-16-17(21(18)34)12(29)5-15(39-16)9-2-3-10(27)11(28)4-9/h2-6,8,14,19-20,22-28,30-36H,7H2,1H3/t8-,14-,19-,20-,22+,23+,24-,25+,26-/m0/s1 |
| InChIKey | KWYUKTMFRNMTME-UVWNYDFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrorhagia velutina (ncbitaxon:308175) | |||
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-C-[2'-O-α-L-rhamnopyranosyl-(1''→2')]-α-L-arabinopyranosylluteolin (CHEBI:70201) has functional parent luteolin (CHEBI:15864) |
| 6-C-[2'-O-α-L-rhamnopyranosyl-(1''→2')]-α-L-arabinopyranosylluteolin (CHEBI:70201) has role plant metabolite (CHEBI:76924) |
| 6-C-[2'-O-α-L-rhamnopyranosyl-(1''→2')]-α-L-arabinopyranosylluteolin (CHEBI:70201) is a disaccharide derivative (CHEBI:63353) |
| 6-C-[2'-O-α-L-rhamnopyranosyl-(1''→2')]-α-L-arabinopyranosylluteolin (CHEBI:70201) is a flavone C-glycoside (CHEBI:83280) |
| 6-C-[2'-O-α-L-rhamnopyranosyl-(1''→2')]-α-L-arabinopyranosylluteolin (CHEBI:70201) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-α-L-mannopyranosyl)-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-L-arabinitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21148644 | Reaxys |
| Citations |
|---|