EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1O |
| InChI | InChI=1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
| InChIKey | MBNGWHIJMBWFHU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracocephalum peregrinum (IPNI:446489-1) | - | PubMed (31906574) | |
| Lepisorus ussuriensis (ncbitaxon:699700) | whole plant (BTO:0001461) | PubMed (26569039) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. tropomyosin-related kinase B receptor agonist An agonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardioprotective agent Any protective agent that is able to prevent damage to the heart. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosmetin (CHEBI:4630) has functional parent luteolin (CHEBI:15864) |
| diosmetin (CHEBI:4630) has role angiogenesis inhibitor (CHEBI:48422) |
| diosmetin (CHEBI:4630) has role anti-inflammatory agent (CHEBI:67079) |
| diosmetin (CHEBI:4630) has role antineoplastic agent (CHEBI:35610) |
| diosmetin (CHEBI:4630) has role antioxidant (CHEBI:22586) |
| diosmetin (CHEBI:4630) has role apoptosis inducer (CHEBI:68495) |
| diosmetin (CHEBI:4630) has role bone density conservation agent (CHEBI:50646) |
| diosmetin (CHEBI:4630) has role cardioprotective agent (CHEBI:77307) |
| diosmetin (CHEBI:4630) has role plant metabolite (CHEBI:76924) |
| diosmetin (CHEBI:4630) has role tropomyosin-related kinase B receptor agonist (CHEBI:140489) |
| diosmetin (CHEBI:4630) has role vasodilator agent (CHEBI:35620) |
| diosmetin (CHEBI:4630) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| diosmetin (CHEBI:4630) is a monomethoxyflavone (CHEBI:25401) |
| diosmetin (CHEBI:4630) is a trihydroxyflavone (CHEBI:27116) |
| diosmetin (CHEBI:4630) is conjugate acid of diosmetin-7-olate (CHEBI:192749) |
| Incoming Relation(s) |
| diosmin (CHEBI:4631) has functional parent diosmetin (CHEBI:4630) |
| diosmetin-7-olate (CHEBI:192749) is conjugate base of diosmetin (CHEBI:4630) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5,7-trihydroxy-4'-methoxyflavone | ChEBI |
| 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | PDBeChem |
| Diosmetin | KEGG COMPOUND |
| Luteolin 4'-methyl ether | KEGG COMPOUND |
| Salinigricoflavonol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 4444931 | ChemSpider |
| 4601 | DrugCentral |
| C00001036 | KNApSAcK |
| C10038 | KEGG COMPOUND |
| CPD-20639 | MetaCyc |
| DB11259 | DrugBank |
| Diosmetin | Wikipedia |
| FDB000861 | FooDB |
| HMDB0029676 | HMDB |
| J8D | PDBeChem |
| KR20080049174 | Patent |
| LMPK12110824 | LIPID MAPS |
| US2011201565 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:294492 | Reaxys |
| CAS:520-34-3 | ChemIDplus |
| CAS:520-34-3 | KEGG COMPOUND |
| Citations |
|---|