EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4630 - diosmetin
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1O |
| InChI | InChI=1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
| InChIKey | MBNGWHIJMBWFHU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus ussuriensis (ncbitaxon:699700) | whole plant (BTO:0001461) | PubMed (26569039) | |
| Dracocephalum peregrinum (IPNI:446489-1) | - | PubMed (31906574) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | tropomyosin-related kinase B receptor agonist An agonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosmetin (CHEBI:4630) has functional parent luteolin (CHEBI:15864) |
| diosmetin (CHEBI:4630) has role angiogenesis inhibitor (CHEBI:48422) |
| diosmetin (CHEBI:4630) has role anti-inflammatory agent (CHEBI:67079) |
| diosmetin (CHEBI:4630) has role antineoplastic agent (CHEBI:35610) |
| diosmetin (CHEBI:4630) has role antioxidant (CHEBI:22586) |
| diosmetin (CHEBI:4630) has role apoptosis inducer (CHEBI:68495) |
| diosmetin (CHEBI:4630) has role bone density conservation agent (CHEBI:50646) |
| diosmetin (CHEBI:4630) has role cardioprotective agent (CHEBI:77307) |
| diosmetin (CHEBI:4630) has role plant metabolite (CHEBI:76924) |
| diosmetin (CHEBI:4630) has role tropomyosin-related kinase B receptor agonist (CHEBI:140489) |
| diosmetin (CHEBI:4630) has role vasodilator agent (CHEBI:35620) |
| diosmetin (CHEBI:4630) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| diosmetin (CHEBI:4630) is a monomethoxyflavone (CHEBI:25401) |
| diosmetin (CHEBI:4630) is a trihydroxyflavone (CHEBI:27116) |
| diosmetin (CHEBI:4630) is conjugate acid of diosmetin-7-olate (CHEBI:192749) |
| Incoming Relation(s) |
| diosmin (CHEBI:4631) has functional parent diosmetin (CHEBI:4630) |
| diosmetin-7-olate (CHEBI:192749) is conjugate base of diosmetin (CHEBI:4630) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Diosmetin | KEGG COMPOUND |
| Luteolin 4'-methyl ether | KEGG COMPOUND |
| 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| 3',5,7-trihydroxy-4'-methoxyflavone | ChEBI |
| Salinigricoflavonol | HMDB |
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C10038 | KEGG COMPOUND |
| LMPK12110824 | LIPID MAPS |
| Diosmetin | Wikipedia |
| HMDB0029676 | HMDB |
| US2011201565 | Patent |
| KR20080049174 | Patent |
| C00001036 | KNApSAcK |
| 4601 | DrugCentral |
| J8D | PDBeChem |
| DB11259 | DrugBank |
| CPD-20639 | MetaCyc |
| 4444931 | ChemSpider |
| FDB000861 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:294492 | Reaxys |
| CAS:520-34-3 | KEGG COMPOUND |
| CAS:520-34-3 | ChemIDplus |
| Citations |
|---|