EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O15 |
| Net Charge | 0 |
| Average Mass | 580.495 |
| Monoisotopic Mass | 580.14282 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@@H]3OC[C@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)15-19(34)14-10(30)4-12(7-1-2-8(28)9(29)3-7)40-24(14)16(20(15)35)25-22(37)17(32)11(31)6-39-25/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1 |
| InChIKey | XBGYTZHKGMCEGE-VYUBKLCTSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carlinoside (CHEBI:3421) has functional parent luteolin (CHEBI:15864) |
| carlinoside (CHEBI:3421) has role anti-inflammatory agent (CHEBI:67079) |
| carlinoside (CHEBI:3421) has role antioxidant (CHEBI:22586) |
| carlinoside (CHEBI:3421) has role metabolite (CHEBI:25212) |
| carlinoside (CHEBI:3421) is a C-glycosyl compound (CHEBI:20857) |
| carlinoside (CHEBI:3421) is a tetrahydroxyflavone (CHEBI:38684) |
| Synonyms | Source |
|---|---|
| 6-C-β-D-glucosyl-8-C-α-L-arabinopyranosylluteolin | ChEBI |
| 8-C-α-L-arabinopyranosyl-6-C-β-D-glucosylluteolin | ChEBI |
| luteolin 6-C-glucoside-8-C-arabinoside | ChEBI |
| luteolin 6-C-β-D-glucopyranoside-8-C-α-L-arabinopyranoside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00006184 | KNApSAcK |
| C10026 | KEGG COMPOUND |
| LMPK12110488 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6563440 | Reaxys |
| CAS:59952-97-5 | KEGG COMPOUND |
| Citations |
|---|