EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O14 |
| Net Charge | 0 |
| Average Mass | 576.507 |
| Monoisotopic Mass | 576.14791 |
| SMILES | [H][C@@]1(O[C@H]2C(=O)[C@@H](O)[C@H](C)O[C@@H]2c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H28O14/c1-8-20(33)23(36)26(41-27-24(37)22(35)19(32)9(2)39-27)25(38-8)18-14(31)7-16-17(21(18)34)13(30)6-15(40-16)10-3-4-11(28)12(29)5-10/h3-9,19-20,22,24-29,31-35,37H,1-2H3/t8-,9-,19-,20-,22+,24+,25+,26-,27-/m0/s1 |
| InChIKey | WGIMZJFXUGTVFX-RUYCBFJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia occidentalis (ncbitaxon:126820) | - | PubMed (21080643) | |
| Petrorhagia velutina (ncbitaxon:308175) | |||
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cassiaoccidentalin B (CHEBI:70205) has functional parent luteolin (CHEBI:15864) |
| cassiaoccidentalin B (CHEBI:70205) has role plant metabolite (CHEBI:76924) |
| cassiaoccidentalin B (CHEBI:70205) is a disaccharide derivative (CHEBI:63353) |
| cassiaoccidentalin B (CHEBI:70205) is a flavone C-glycoside (CHEBI:83280) |
| cassiaoccidentalin B (CHEBI:70205) is a secondary α-hydroxy ketone (CHEBI:2468) |
| cassiaoccidentalin B (CHEBI:70205) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (1R)-1,5-anhydro-6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-L-ribo-hex-3-ulose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8530621 | Reaxys |
| Citations |
|---|