EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-6-14-17(27)19(29)20(30)21(32-14)16-11(26)5-13-15(18(16)28)10(25)4-12(31-13)7-1-2-8(23)9(24)3-7/h1-5,14,17,19-24,26-30H,6H2/t14-,17-,19+,20-,21+/m1/s1 |
| InChIKey | ODBRNZZJSYPIDI-VJXVFPJBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrorhagia velutina (ncbitaxon:308175) | |||
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| Sasa borealis (ncbitaxon:591242) | - | PubMed (21080643) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoorientin (CHEBI:17965) has functional parent luteolin (CHEBI:15864) |
| isoorientin (CHEBI:17965) has role antineoplastic agent (CHEBI:35610) |
| isoorientin (CHEBI:17965) has role radical scavenger (CHEBI:48578) |
| isoorientin (CHEBI:17965) is a flavone C-glycoside (CHEBI:83280) |
| isoorientin (CHEBI:17965) is a tetrahydroxyflavone (CHEBI:38684) |
| isoorientin (CHEBI:17965) is conjugate acid of isoorientin(1−) (CHEBI:58333) |
| Incoming Relation(s) |
| 3''-oxohomoorientin(2−) (CHEBI:229565) has functional parent isoorientin (CHEBI:17965) |
| 7-O-(6-feruoylglucosyl)isoorientin (CHEBI:75517) has functional parent isoorientin (CHEBI:17965) |
| 7-O-(6-sinapoylglucosyl)isoorientin (CHEBI:75516) has functional parent isoorientin (CHEBI:17965) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]isoorientin (CHEBI:75515) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 2''-O-glucoside (CHEBI:131779) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 7-O-glucoside (CHEBI:75514) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) has functional parent isoorientin (CHEBI:17965) |
| swertiajaponin (CHEBI:9369) has functional parent isoorientin (CHEBI:17965) |
| isoorientin(1−) (CHEBI:58333) is conjugate base of isoorientin (CHEBI:17965) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-5,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |
| Homoorientin | ChemIDplus |
| Isoorientin | KEGG COMPOUND |
| Luteolin-6-C-β-D-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001055 | KNApSAcK |
| C01821 | KEGG COMPOUND |
| Isoorientin | Wikipedia |
| LMPK12110469 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68256 | Reaxys |
| CAS:4261-42-1 | ChemIDplus |
| CAS:4261-42-1 | KEGG COMPOUND |
| Citations |
|---|