EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1cc(-c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | UHNXUSWGOJMEFO-QNDFHXLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Olea europaea (ncbitaxon:4146) | leaf (BTO:0000713) | PubMed (22014168) | Methanolic and aqueous extract of dried olive leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) has functional parent luteolin (CHEBI:15864) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) has role plant metabolite (CHEBI:76924) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) is a glycosyloxyflavone (CHEBI:50018) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) is a monosaccharide derivative (CHEBI:63367) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) is a trihydroxyflavone (CHEBI:27116) |
| luteolin-4'-O-β-D-glucopyranoside (CHEBI:68986) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5,7,3'-trihydroxyflavone 4'-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:65285 | Reaxys |
| Citations |
|---|