EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1cc(-c2cc(=O)c3c(OC)cc(O)cc3o2)ccc1O |
| InChI | InChI=1S/C17H14O6/c1-21-14-5-9(3-4-11(14)19)13-8-12(20)17-15(22-2)6-10(18)7-16(17)23-13/h3-8,18-19H,1-2H3 |
| InChIKey | JDMXMMBASFOTIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,3'-di-O-methylluteolin (CHEBI:69455) has functional parent luteolin (CHEBI:15864) |
| 5,3'-di-O-methylluteolin (CHEBI:69455) has role plant metabolite (CHEBI:76924) |
| 5,3'-di-O-methylluteolin (CHEBI:69455) is a dihydroxyflavone (CHEBI:38686) |
| 5,3'-di-O-methylluteolin (CHEBI:69455) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-methoxy-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| chrysoeriol 5-methyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1326972 | Reaxys |
| Citations |
|---|