EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-6-14-17(28)18(29)19(30)21(32-14)16-11(26)4-10(25)15-12(27)5-13(31-20(15)16)7-1-2-8(23)9(24)3-7/h1-5,14,17-19,21-26,28-30H,6H2/t14-,17-,18+,19-,21+/m1/s1 |
| InChIKey | PLAPMLGJVGLZOV-VPRICQMDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orientin (CHEBI:7781) has functional parent luteolin (CHEBI:15864) |
| orientin (CHEBI:7781) has role antioxidant (CHEBI:22586) |
| orientin (CHEBI:7781) has role metabolite (CHEBI:25212) |
| orientin (CHEBI:7781) is a C-glycosyl compound (CHEBI:20857) |
| orientin (CHEBI:7781) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| orientin (CHEBI:7781) is a tetrahydroxyflavone (CHEBI:38684) |
| Incoming Relation(s) |
| 3''-oxoorientin(1−) (CHEBI:229564) has functional parent orientin (CHEBI:7781) |
| orientin 2''-O-rhamnoside (CHEBI:142904) has functional parent orientin (CHEBI:7781) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-8-β-D-glucopyranosyl-5,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Orientin | KEGG COMPOUND |
| Luteolin 8-C-glucoside | KEGG COMPOUND |
| 8-β-D-glucosylluteolin | ChEBI |
| Lutexin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10114 | KEGG COMPOUND |
| LMPK12110470 | LIPID MAPS |
| Orientin | Wikipedia |
| HMDB0030614 | HMDB |
| C00001078 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:69376 | Reaxys |
| CAS:28608-75-5 | KEGG COMPOUND |
| CAS:28608-75-5 | ChemIDplus |
| Citations |
|---|