EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O10/c1-8-18(26)19(27)20(28)21(29-8)30-10-5-13(24)17-14(25)7-15(31-16(17)6-10)9-2-3-11(22)12(23)4-9/h2-8,18-24,26-28H,1H3/t8-,18-,19+,20+,21-/m0/s1 |
| InChIKey | GRBYFYORPBZEIN-RWKYHZLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) has functional parent luteolin (CHEBI:15864) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) has role plant metabolite (CHEBI:76924) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) is a glycosyloxyflavone (CHEBI:50018) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) is a monosaccharide derivative (CHEBI:63367) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) is a trihydroxyflavone (CHEBI:27116) |
| luteolin-7-O-α-L-rhamnoside (CHEBI:70030) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-1-benzopyran-7-yl 6-deoxy-α-L-mannopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6546380 | Reaxys |
| Citations |
|---|