EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O14 |
| Net Charge | 0 |
| Average Mass | 576.507 |
| Monoisotopic Mass | 576.14791 |
| SMILES | [H][C@]1(O[C@H]2[C@H](O)C(=O)[C@H](C)O[C@@H]2c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)O[C@H](C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H28O14/c1-8-20(33)23(36)26(41-27-24(37)22(35)19(32)9(2)39-27)25(38-8)18-14(31)7-16-17(21(18)34)13(30)6-15(40-16)10-3-4-11(28)12(29)5-10/h3-9,19,22-29,31-32,34-37H,1-2H3/t8-,9+,19+,22-,23+,24-,25+,26-,27+/m0/s1 |
| InChIKey | GKLSYIMLZDYQBJ-CGOKOBCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrorhagia velutina (ncbitaxon:308175) | |||
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| Zea mays (ncbitaxon:4577) | - | PubMed (21080643) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maysin (CHEBI:70206) has functional parent luteolin (CHEBI:15864) |
| maysin (CHEBI:70206) has role insecticide (CHEBI:24852) |
| maysin (CHEBI:70206) has role neuroprotective agent (CHEBI:63726) |
| maysin (CHEBI:70206) has role plant metabolite (CHEBI:76924) |
| maysin (CHEBI:70206) is a disaccharide derivative (CHEBI:63353) |
| maysin (CHEBI:70206) is a flavone C-glycoside (CHEBI:83280) |
| maysin (CHEBI:70206) is a secondary α-hydroxy ketone (CHEBI:2468) |
| maysin (CHEBI:70206) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (6R)-2,6-anhydro-1-deoxy-5-O-(6-deoxy-α-D-mannopyranosyl)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-D-xylo-hex-3-ulose |
| Manual Xrefs | Databases |
|---|---|
| CPD-9588 | MetaCyc |
| HMDB0037419 | HMDB |
| KR20110026271 | Patent |
| LMPK12110512 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:70255-49-1 | ChemIDplus |
| Citations |
|---|