EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O14 |
| Net Charge | 0 |
| Average Mass | 576.507 |
| Monoisotopic Mass | 576.14791 |
| SMILES | [H][C@]1(O[C@H]2[C@H](O)C(=O)[C@H](C)O[C@@H]2c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)O[C@H](C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H28O14/c1-8-20(33)23(36)26(41-27-24(37)22(35)19(32)9(2)39-27)25(38-8)18-14(31)7-16-17(21(18)34)13(30)6-15(40-16)10-3-4-11(28)12(29)5-10/h3-9,19,22-29,31-32,34-37H,1-2H3/t8-,9+,19+,22-,23+,24-,25+,26-,27+/m0/s1 |
| InChIKey | GKLSYIMLZDYQBJ-CGOKOBCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | - | PubMed (21080643) | |
| Petrorhagia velutina (ncbitaxon:308175) | |||
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maysin (CHEBI:70206) has functional parent luteolin (CHEBI:15864) |
| maysin (CHEBI:70206) has role insecticide (CHEBI:24852) |
| maysin (CHEBI:70206) has role neuroprotective agent (CHEBI:63726) |
| maysin (CHEBI:70206) has role plant metabolite (CHEBI:76924) |
| maysin (CHEBI:70206) is a disaccharide derivative (CHEBI:63353) |
| maysin (CHEBI:70206) is a flavone C-glycoside (CHEBI:83280) |
| maysin (CHEBI:70206) is a secondary α-hydroxy ketone (CHEBI:2468) |
| maysin (CHEBI:70206) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (6R)-2,6-anhydro-1-deoxy-5-O-(6-deoxy-α-D-mannopyranosyl)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-D-xylo-hex-3-ulose |
| Manual Xrefs | Databases |
|---|---|
| KR20110026271 | Patent |
| HMDB0037419 | HMDB |
| LMPK12110512 | LIPID MAPS |
| CPD-9588 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:70255-49-1 | ChemIDplus |
| Citations |
|---|