EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(Oc3cc(-c4cc(=O)c5c(O)cc(O)cc5o4)ccc3O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-16-8-20(34)29-22(36)12-24(39-27(29)10-16)14-1-4-18(5-2-14)38-26-7-15(3-6-19(26)33)25-13-23(37)30-21(35)9-17(32)11-28(30)40-25/h1-13,31-35H |
| InChIKey | NNPGECDACGBKDH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cespedesia spathulata (ncbitaxon:179739) | leaf (BTO:0000713) | PubMed (34495202) | |
| Lonicera japonica (ncbitaxon:105884) | - | DOI (10.1006/bbrc.1994.2741 ) | |
| Ochna afzelii (ncbitaxon:1501052) | leaf (BTO:0000713) | PubMed (36148610) | |
| Ochna kibbiensis (ncbitaxon:2699566) | - | PubMed (28032512) | |
| Ochna pretoriensis (ncbitaxon:1679402) | - | PubMed (23413563) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antiatherogenic agent A cardiovascular drug that prevents atherogenesis, the accumulation of lipid-containing plaques on the innermost layers of the arteries. Compare with antiatherosclerotic agent. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochnaflavone (CHEBI:194126) has functional parent apigenin (CHEBI:18388) |
| ochnaflavone (CHEBI:194126) has functional parent luteolin (CHEBI:15864) |
| ochnaflavone (CHEBI:194126) has role anti-inflammatory agent (CHEBI:67079) |
| ochnaflavone (CHEBI:194126) has role antiatherogenic agent (CHEBI:50855) |
| ochnaflavone (CHEBI:194126) has role antibacterial agent (CHEBI:33282) |
| ochnaflavone (CHEBI:194126) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| ochnaflavone (CHEBI:194126) has role leukotriene antagonist (CHEBI:49159) |
| ochnaflavone (CHEBI:194126) has role plant metabolite (CHEBI:76924) |
| ochnaflavone (CHEBI:194126) is a aromatic ether (CHEBI:35618) |
| ochnaflavone (CHEBI:194126) is a biflavonoid (CHEBI:50128) |
| ochnaflavone (CHEBI:194126) is a hydroxyflavone (CHEBI:24698) |
| IUPAC Name |
|---|
| 2-{4-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenoxy]phenyl}-5,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-{4-[5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenoxy]phenyl}-5,7-dihydroxy-4H-1-benzopyran-4-one | IUPAC |
| 2-[4-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]phenyl]-5,7-dihydroxychromen-4-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 4590862 | ChemSpider |
| C00006542 | KNApSAcK |
| Ochnaflavone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:50276-96-5 | SUBMITTER |
| Citations |
|---|