EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O17 |
| Net Charge | 0 |
| Average Mass | 626.520 |
| Monoisotopic Mass | 626.14830 |
| SMILES | [H][C@]1(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@@H](Oc2cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c(O)c2O)[C@@H]1O |
| InChI | InChI=1S/C27H30O17/c28-6-15-19(34)22(37)23(38)26(42-15)44-25-20(35)16(7-29)43-27(24(25)39)41-14-5-13-17(21(36)18(14)33)11(32)4-12(40-13)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2/t15-,16-,19-,20-,22+,23-,24-,25+,26+,27-/m1/s1 |
| InChIKey | YNOSNIYDHUBEBU-HGKFCXGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Globularia alypum (IPNI:813050-1) | aerial part (BTO:0001658) | PubMed (16124783) | |
| Globularia cordifolia (ncbitaxon:69063) | leaf (BTO:0000713) | PubMed (16124783) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) has functional parent luteolin (CHEBI:15864) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) has role antioxidant (CHEBI:22586) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) has role metabolite (CHEBI:25212) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) is a disaccharide derivative (CHEBI:63353) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) is a glycosyloxyflavone (CHEBI:50018) |
| 6-hydroxyluteolin 7-O-laminaribioside (CHEBI:66046) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-4-oxo-4H-chromen-7-yl 3-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5,6,3',4'-tetrahydroxyflavone-7-O-β-D-glucopyranosyl-(1→3)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769702 | Reaxys |
| Citations |
|---|