EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O2 |
| Net Charge | 0 |
| Average Mass | 148.161 |
| Monoisotopic Mass | 148.05243 |
| SMILES | O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| InChIKey | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sarmentosum (ncbitaxon:405319) | |||
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| (2E)-3-phenylprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| trans-Cinnamate | KEGG COMPOUND |
| trans-Cinnamic acid | KEGG COMPOUND |
| (2E)-3-phenylacrylic acid | PDBeChem |
| trans-β-carboxystyrene | NIST Chemistry WebBook |
| (E)-cinnamic acid | NIST Chemistry WebBook |
| trans-3-phenylacrylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00423 | KEGG COMPOUND |
| TCA | PDBeChem |
| Cinnamic_acid | Wikipedia |
| CPD-674 | MetaCyc |
| HMDB0000930 | HMDB |
| C00000170 | KNApSAcK |
| C00029961 | KNApSAcK |
| C10438 | KEGG COMPOUND |
| Citations |
|---|