EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1ccccc1/C=C/C(=O)O |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+ |
| InChIKey | FEGVSPGUHMGGBO-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS309) | ||
| - | PubMed (26641455) | ||
| Cinnamomum aromaticum (ncbitaxon:119260) | bark (BTO:0001301) | PubMed (20572266) | |
| Pulsatilla cernua (ncbitaxon:231674) | root (BTO:0001188) | PubMed (11600003) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-methoxycinnamic acid (CHEBI:136676) has functional parent trans-cinnamic acid (CHEBI:35697) |
| (E)-2-methoxycinnamic acid (CHEBI:136676) has role Brassica napus metabolite (CHEBI:140165) |
| (E)-2-methoxycinnamic acid (CHEBI:136676) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| (E)-2-methoxycinnamic acid (CHEBI:136676) is a cinnamic acids (CHEBI:23252) |
| (E)-2-methoxycinnamic acid (CHEBI:136676) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| (2E)-3-(2-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-methoxycinnamic acid | ChEBI |
| (E)-3-(2-Methoxyphenyl)-2-propenoic acid | NIST Chemistry WebBook |
| (E)-o-Methoxycinnamic acid | ChemIDplus |
| (E)-3-(2-methoxyphenyl)acrylic acid | ChEBI |
| trans-2-methoxycinnamic acid | ChEBI |
| Citations |
|---|