EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41NO17 |
| Net Charge | 0 |
| Average Mass | 735.692 |
| Monoisotopic Mass | 735.23745 |
| SMILES | N#C[C@@H](O[C@@H]1O[C@H](CO[C@@H]2OC[C@@H](OC(=O)/C=C/c3ccc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C34H41NO17/c35-12-19(17-4-2-1-3-5-17)50-34-31(45)28(42)25(39)22(52-34)15-47-32-29(43)26(40)21(14-46-32)49-23(37)11-8-16-6-9-18(10-7-16)48-33-30(44)27(41)24(38)20(13-36)51-33/h1-11,19-22,24-34,36,38-45H,13-15H2/b11-8+/t19-,20-,21-,22-,24-,25-,26+,27+,28+,29-,30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | HIRMPNNQGZEXOM-ZXSTXTMUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthemis glycoside B (CHEBI:2748) has functional parent trans-cinnamic acid (CHEBI:35697) |
| anthemis glycoside B (CHEBI:2748) is a O-acyl carbohydrate (CHEBI:52782) |
| anthemis glycoside B (CHEBI:2748) is a anthemis glycoside (CHEBI:50021) |
| anthemis glycoside B (CHEBI:2748) is a disaccharide derivative (CHEBI:63353) |
| anthemis glycoside B (CHEBI:2748) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| (2S)-[6-O-(4-O-{(2E)-3-[4-(β-D-glucopyranosyloxy)phenyl]prop-2-enoyl}-β-D-xylopyranosyl)-β-D-glucopyranosyloxy](phenyl)acetonitrile |
| Synonym | Source |
|---|---|
| Anthemis glycoside B | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:89354-49-4 | KEGG COMPOUND |
| CAS:89354-49-4 | ChemIDplus |