EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C71H114O25 |
| Net Charge | 0 |
| Average Mass | 1367.668 |
| Monoisotopic Mass | 1366.76492 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O[C@]3([H])O[C@@H](C)[C@H](OC(=O)C(C)C)[C@@H](OC(=O)/C=C/c4ccccc4)[C@H]3O)[C@H](C)O[C@@H](O[C@@]3([H])[C@H](C)O[C@H]4O[C@@]5([H])[C@H](O[C@@H](CCCCC)CCCCCCCCCC(=O)O[C@H]3[C@H]4O)O[C@H](C)[C@H](O)[C@@H]5O)[C@@H]2OC(=O)CCCCCCCCCCC)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C71H114O25/c1-10-12-14-15-16-17-20-23-31-37-49(73)91-65-64(96-67-55(79)53(77)51(75)41(5)83-67)60(93-68-56(80)61(58(43(7)85-68)92-66(82)40(3)4)90-50(74)39-38-46-32-27-25-28-33-46)45(9)87-71(65)94-59-44(8)86-69-57(81)62(59)89-48(72)36-30-24-21-18-19-22-29-35-47(34-26-13-11-2)88-70-63(95-69)54(78)52(76)42(6)84-70/h25,27-28,32-33,38-45,47,51-65,67-71,75-81H,10-24,26,29-31,34-37H2,1-9H3/b39-38+/t41-,42+,43-,44-,45-,47-,51-,52-,53+,54-,55+,56+,57+,58-,59-,60-,61-,62-,63+,64+,65+,67-,68-,69-,70-,71-/m0/s1 |
| InChIKey | GEIFMZOIUWDOQZ-DQRIPJEXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ipomoea pes-caprae (ncbitaxon:89656) | aerial part (BTO:0001658) | PubMed (21338052) | The air-dried aerial parts were powdered and refluxed with 95% EtOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pescaprein XXV (CHEBI:67855) has functional parent trans-cinnamic acid (CHEBI:35697) |
| pescaprein XXV (CHEBI:67855) has functional parent dodecanoic acid (CHEBI:30805) |
| pescaprein XXV (CHEBI:67855) has functional parent isobutyric acid (CHEBI:16135) |
| pescaprein XXV (CHEBI:67855) has functional parent jalapinolic acid (CHEBI:75785) |
| pescaprein XXV (CHEBI:67855) has role metabolite (CHEBI:25212) |
| pescaprein XXV (CHEBI:67855) is a cinnamate ester (CHEBI:36087) |
| pescaprein XXV (CHEBI:67855) is a dodecanoate ester (CHEBI:87659) |
| pescaprein XXV (CHEBI:67855) is a macrocyclic lactone (CHEBI:63944) |
| pescaprein XXV (CHEBI:67855) is a pentasaccharide derivative (CHEBI:63566) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523284 | Reaxys |
| Citations |
|---|