EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H50O9 |
| Net Charge | 0 |
| Average Mass | 662.820 |
| Monoisotopic Mass | 662.34548 |
| SMILES | [H][C@]12OC3(/C=C/CCCCCCC)OC4(C(C)C(OC(=O)/C=C/c5ccccc5)[C@]1(C(=C)C)O3)C1C=C(C)CC1(O)C(O)C1(CO)OC1C42 |
| InChI | InChI=1S/C39H50O9/c1-6-7-8-9-10-11-15-20-37-46-33-30-32-36(23-40,45-32)34(42)35(43)22-25(4)21-28(35)39(30,48-37)26(5)31(38(33,47-37)24(2)3)44-29(41)19-18-27-16-13-12-14-17-27/h12-21,26,28,30-34,40,42-43H,2,6-11,22-23H2,1,3-5H3/b19-18+,20-15+/t26?,28?,30?,31?,32?,33-,34?,35?,36?,37?,38+,39?/m1/s1 |
| InChIKey | KEUMOFLVVHIGDK-VTQXMHCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphne mucronata (IPNI:831300-1) | leaf (BTO:0000713) | PubMed (17366739) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gnidilatimonoein (CHEBI:65978) has functional parent trans-cinnamic acid (CHEBI:35697) |
| gnidilatimonoein (CHEBI:65978) has role antineoplastic agent (CHEBI:35610) |
| gnidilatimonoein (CHEBI:65978) has role apoptosis inducer (CHEBI:68495) |
| gnidilatimonoein (CHEBI:65978) has role metabolite (CHEBI:25212) |
| gnidilatimonoein (CHEBI:65978) is a bridged compound (CHEBI:35990) |
| gnidilatimonoein (CHEBI:65978) is a cinnamate ester (CHEBI:36087) |
| gnidilatimonoein (CHEBI:65978) is a diterpenoid (CHEBI:23849) |
| gnidilatimonoein (CHEBI:65978) is a epoxide (CHEBI:32955) |
| gnidilatimonoein (CHEBI:65978) is a organic heterohexacyclic compound (CHEBI:51914) |
| gnidilatimonoein (CHEBI:65978) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (3aR,10aS)-5,5a-dihydroxy-4a-(hydroxymethyl)-7,9-dimethyl-2-[(1E)-non-1-en-1-yl]-10a-(prop-1-en-2-yl)-3a,3c,4a,5,5a,6,8a,9,10,10a-decahydro-3bH-2,8b-epoxyoxireno[6,7]azuleno[5,4-e][1,3]benzodioxol-10-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10048596 | Reaxys |
| Citations |
|---|