EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H50O9 |
| Net Charge | 0 |
| Average Mass | 662.820 |
| Monoisotopic Mass | 662.34548 |
| SMILES | [H][C@]12OC3(/C=C/CCCCCCC)OC4(C(C)C(OC(=O)/C=C/c5ccccc5)[C@]1(C(=C)C)O3)C1C=C(C)CC1(O)C(O)C1(CO)OC1C42 |
| InChI | InChI=1S/C39H50O9/c1-6-7-8-9-10-11-15-20-37-46-33-30-32-36(23-40,45-32)34(42)35(43)22-25(4)21-28(35)39(30,48-37)26(5)31(38(33,47-37)24(2)3)44-29(41)19-18-27-16-13-12-14-17-27/h12-21,26,28,30-34,40,42-43H,2,6-11,22-23H2,1,3-5H3/b19-18+,20-15+/t26?,28?,30?,31?,32?,33-,34?,35?,36?,37?,38+,39?/m1/s1 |
| InChIKey | KEUMOFLVVHIGDK-VTQXMHCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphne mucronata (IPNI:831300-1) | leaf (BTO:0000713) | PubMed (17366739) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gnidilatimonoein (CHEBI:65978) has functional parent trans-cinnamic acid (CHEBI:35697) |
| gnidilatimonoein (CHEBI:65978) has role antineoplastic agent (CHEBI:35610) |
| gnidilatimonoein (CHEBI:65978) has role apoptosis inducer (CHEBI:68495) |
| gnidilatimonoein (CHEBI:65978) has role metabolite (CHEBI:25212) |
| gnidilatimonoein (CHEBI:65978) is a bridged compound (CHEBI:35990) |
| gnidilatimonoein (CHEBI:65978) is a cinnamate ester (CHEBI:36087) |
| gnidilatimonoein (CHEBI:65978) is a diterpenoid (CHEBI:23849) |
| gnidilatimonoein (CHEBI:65978) is a epoxide (CHEBI:32955) |
| gnidilatimonoein (CHEBI:65978) is a organic heterohexacyclic compound (CHEBI:51914) |
| gnidilatimonoein (CHEBI:65978) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (3aR,10aS)-5,5a-dihydroxy-4a-(hydroxymethyl)-7,9-dimethyl-2-[(1E)-non-1-en-1-yl]-10a-(prop-1-en-2-yl)-3a,3c,4a,5,5a,6,8a,9,10,10a-decahydro-3bH-2,8b-epoxyoxireno[6,7]azuleno[5,4-e][1,3]benzodioxol-10-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10048596 | Reaxys |
| Citations |
|---|