EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxycinnamic acid (CHEBI:86549) has functional parent trans-cinnamic acid (CHEBI:35697) |
| 3,4-dimethoxycinnamic acid (CHEBI:86549) is a methoxycinnamic acid (CHEBI:61407) |
| 3,4-dimethoxycinnamic acid (CHEBI:86549) is conjugate acid of 3,4-dimethoxy-(E)-cinnamate (CHEBI:229728) |
| Incoming Relation(s) |
| methyl-3,4-dimethoxycinnamate (CHEBI:86899) has functional parent 3,4-dimethoxycinnamic acid (CHEBI:86549) |
| 3,4-dimethoxy-(E)-cinnamate (CHEBI:229728) is conjugate base of 3,4-dimethoxycinnamic acid (CHEBI:86549) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2215201 | Reaxys |
| CAS:14737-89-4 | ChemIDplus |