EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7IO2S |
| Net Charge | 0 |
| Average Mass | 306.124 |
| Monoisotopic Mass | 305.92115 |
| SMILES | O=C(O)/C(S)=C/c1ccc(I)cc1 |
| InChI | InChI=1S/C9H7IO2S/c10-7-3-1-6(2-4-7)5-8(13)9(11)12/h1-5,13H,(H,11,12)/b8-5- |
| InChIKey | DJCVSFWGKYHMKH-YVMONPNESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. calpain inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of any calpain. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) has functional parent trans-cinnamic acid (CHEBI:35697) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) has role apoptosis inhibitor (CHEBI:68494) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) has role calpain inhibitor (CHEBI:82824) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) is a cinnamic acids (CHEBI:23252) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) is a organoiodine compound (CHEBI:37142) |
| (Z)-3-(4-iodophenyl)-2-mercaptoacrylic acid (CHEBI:130910) is a thioenol (CHEBI:59722) |
| IUPAC Name |
|---|
| (2Z )-3-(4-iodophenyl)-2-sulfanylprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(4-Iodophenyl)-2-mercapto-(Z)-2-propenoic acid | ChemIDplus |
| 4'-iodo-2-mercaptocinnamic acid | ChEBI |
| PD 150,606 | ChEBI |
| PD 150606 | ChEBI |
| PD-150,606 | ChEBI |
| PD-150606 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10069045 | Reaxys |
| CAS:179528-45-1 | ChemIDplus |
| Citations |
|---|