EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO2 |
| Net Charge | 0 |
| Average Mass | 267.328 |
| Monoisotopic Mass | 267.12593 |
| SMILES | O=C(/C=C/c1ccccc1)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C17H17NO2/c19-16-9-6-15(7-10-16)12-13-18-17(20)11-8-14-4-2-1-3-5-14/h1-11,19H,12-13H2,(H,18,20)/b11-8+ |
| InChIKey | KGOYCHSKGXJDND-DHZHZOJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis racemosa (ncbitaxon:54431) | whole plant (BTO:0001461) | PubMed (32495600) | |
| Dendrobium moniliforme (ncbitaxon:142614) | whole plant (BTO:0001461) | PubMed (26132274) | |
| Oryza sativa (ncbitaxon:4530) | - | PubMed (25212867) | Strain: OM 5930 |
| Lycianthes biflora (ncbitaxon:241757) | - | PubMed (12579800) |
| Roles Classification |
|---|
| Biological Roles: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has functional parent trans-cinnamic acid (CHEBI:35697) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has functional parent tyramine (CHEBI:15760) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has role allelochemical (CHEBI:62215) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has role antimicrobial agent (CHEBI:33281) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has role phytoalexin (CHEBI:26115) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has role platelet aggregation inhibitor (CHEBI:50427) |
| N-trans-cinnamoyltyramine (CHEBI:177872) is a cinnamamides (CHEBI:23247) |
| N-trans-cinnamoyltyramine (CHEBI:177872) is a phenols (CHEBI:33853) |
| N-trans-cinnamoyltyramine (CHEBI:177872) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-N-[2-(4-hydroxyphenyl)ethyl]-3-phenylprop-2-enamide |
| Synonyms | Source |
|---|---|
| cinnamoyltyramine | ChEBI |
| N-cinnamoyltyramine | ChEBI |
| trans-cinnamoyl-p-hydroxybenzenethylamine | ChEBI |
| (2E)-N-[2-(4-hydroxyphenyl)ethyl]-3-phenyl-2-propenamide | ChEBI |
| (E)-N-[2-(4-hydroxyphenyl)ethyl]-3-phenyl-2-propenamide | ChEBI |
| UniProt Name | Source |
|---|---|
| N-[(E)-cinnamoyl]tyramine | UniProt |
| Citations |
|---|